C22H33N5O5S — CID 16613256
[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone (PubChem CID 16613256) has the molecular formula C22H33N5O5S and a molecular weight of 479.60 g/mol. Its IUPAC name is [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone.
| Compound Name | [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 16613256 |
| Molecular Formula | C22H33N5O5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | [4-(azepan-1-ylsulfonyl)piperazin-1-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccccc2[N+](=O)[O-])CC1)N1CCN(S(=O)(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C22H33N5O5S/c28-22(19-9-13-23(14-10-19)20-7-3-4-8-21(20)27(29)30)24-15-17-26(18-16-24)33(31,32)25-11-5-1-2-6-12-25/h3-4,7-8,19H,1-2,5-6,9-18H2 |
| InChIKey | TZEDBBOCFJADBG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 107.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|