C20H29N3O4S — CID 99785185
[(1S)-2,2-diethyl-1-oxo-1,4-thiazinan-4-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone (PubChem CID 99785185) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is [(1S)-2,2-diethyl-1-oxo-1,4-thiazinan-4-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone.
| Compound Name | [(1S)-2,2-diethyl-1-oxo-1,4-thiazinan-4-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 99785185 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | [(1S)-2,2-diethyl-1-oxo-1,4-thiazinan-4-yl]-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
| SMILES | CCC1(CC)CN(C(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)CC[S@@]1=O |
| InChI | InChI=1S/C20H29N3O4S/c1-3-20(4-2)15-22(13-14-28(20)27)19(24)16-9-11-21(12-10-16)17-7-5-6-8-18(17)23(25)26/h5-8,16H,3-4,9-15H2,1-2H3/t28-/m0/s1 |
| InChIKey | GCCUCPNVZRGLCO-NDEPHWFRSA-N |
| XLogP | 2.96 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|