C24H30N4O3 — CID 16613193
(4-benzyl-1,4-diazepan-1-yl)-[1-(2-nitrophenyl)piperidin-4-yl]methanone (PubChem CID 16613193) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is (4-benzyl-1,4-diazepan-1-yl)-[1-(2-nitrophenyl)piperidin-4-yl]methanone.
| Compound Name | (4-benzyl-1,4-diazepan-1-yl)-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 16613193 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (4-benzyl-1,4-diazepan-1-yl)-[1-(2-nitrophenyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccccc2[N+](=O)[O-])CC1)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N4O3/c29-24(27-14-6-13-25(17-18-27)19-20-7-2-1-3-8-20)21-11-15-26(16-12-21)22-9-4-5-10-23(22)28(30)31/h1-5,7-10,21H,6,11-19H2 |
| InChIKey | WNGQWSANLDUMDV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|