C25H33N5O3 — CID 55728023
N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 55728023) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55728023 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | CN1CCN(Cc2ccc(CNC(=O)C3CCN(c4ccccc4[N+](=O)[O-])CC3)cc2)CC1 |
| InChI | InChI=1S/C25H33N5O3/c1-27-14-16-28(17-15-27)19-21-8-6-20(7-9-21)18-26-25(31)22-10-12-29(13-11-22)23-4-2-3-5-24(23)30(32)33/h2-9,22H,10-19H2,1H3,(H,26,31) |
| InChIKey | GEQDKHQBHBQIGD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|