C17H20N2O6 — CID 39964339
[(3R,5S)-5-methyl-2-oxooxolan-3-yl] 1-(2-nitrophenyl)piperidine-4-carboxylate (PubChem CID 39964339) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 1-(2-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 39964339 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [(3R,5S)-5-methyl-2-oxooxolan-3-yl] 1-(2-nitrophenyl)piperidine-4-carboxylate |
| SMILES | C[C@H]1C[C@@H](OC(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)C(=O)O1 |
| InChI | InChI=1S/C17H20N2O6/c1-11-10-15(17(21)24-11)25-16(20)12-6-8-18(9-7-12)13-4-2-3-5-14(13)19(22)23/h2-5,11-12,15H,6-10H2,1H3/t11-,15+/m0/s1 |
| InChIKey | IGYOFVRSDKBUOK-XHDPSFHLSA-N |
| XLogP | 2.06 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|