C16H20N4O4 — CID 4883131
4-(3-nitro-4-piperidin-1-ylbenzoyl)piperazin-2-one (PubChem CID 4883131) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-(3-nitro-4-piperidin-1-ylbenzoyl)piperazin-2-one.
| Compound Name | 4-(3-nitro-4-piperidin-1-ylbenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 4883131 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-(3-nitro-4-piperidin-1-ylbenzoyl)piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)CCN1 |
| InChI | InChI=1S/C16H20N4O4/c21-15-11-19(9-6-17-15)16(22)12-4-5-13(14(10-12)20(23)24)18-7-2-1-3-8-18/h4-5,10H,1-3,6-9,11H2,(H,17,21) |
| InChIKey | MLOJLTBBOYURBI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|