C22H24N4O4 — CID 94134262
(7S)-1-(3-nitro-4-pyrrolidin-1-ylbenzoyl)-7-phenyl-1,4-diazepan-5-one (PubChem CID 94134262) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is (7S)-1-(3-nitro-4-pyrrolidin-1-ylbenzoyl)-7-phenyl-1,4-diazepan-5-one.
| Compound Name | (7S)-1-(3-nitro-4-pyrrolidin-1-ylbenzoyl)-7-phenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 94134262 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (7S)-1-(3-nitro-4-pyrrolidin-1-ylbenzoyl)-7-phenyl-1,4-diazepan-5-one |
| SMILES | O=C1C[C@@H](c2ccccc2)N(C(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)CCN1 |
| InChI | InChI=1S/C22H24N4O4/c27-21-15-19(16-6-2-1-3-7-16)25(13-10-23-21)22(28)17-8-9-18(20(14-17)26(29)30)24-11-4-5-12-24/h1-3,6-9,14,19H,4-5,10-13,15H2,(H,23,27)/t19-/m0/s1 |
| InChIKey | ZKINDVMGQKCJDH-IBGZPJMESA-N |
| XLogP | 2.90 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|