C19H20N2O3S — CID 95141444
(7S)-1-[4-[(R)-methylsulfinyl]benzoyl]-7-phenyl-1,4-diazepan-5-one (PubChem CID 95141444) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is (7S)-1-[4-[(R)-methylsulfinyl]benzoyl]-7-phenyl-1,4-diazepan-5-one.
| Compound Name | (7S)-1-[4-[(R)-methylsulfinyl]benzoyl]-7-phenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95141444 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (7S)-1-[4-[(R)-methylsulfinyl]benzoyl]-7-phenyl-1,4-diazepan-5-one |
| SMILES | C[S@@](=O)c1ccc(C(=O)N2CCNC(=O)C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-25(24)16-9-7-15(8-10-16)19(23)21-12-11-20-18(22)13-17(21)14-5-3-2-4-6-14/h2-10,17H,11-13H2,1H3,(H,20,22)/t17-,25+/m0/s1 |
| InChIKey | PENUESAKAAOIEA-SSOJOUAXSA-N |
| XLogP | 2.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |