C20H25N3O2 — CID 56817974
1-(1-ethyl-2,5-dimethylpyrrole-3-carbonyl)-7-phenyl-1,4-diazepan-5-one (PubChem CID 56817974) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-(1-ethyl-2,5-dimethylpyrrole-3-carbonyl)-7-phenyl-1,4-diazepan-5-one.
| Compound Name | 1-(1-ethyl-2,5-dimethylpyrrole-3-carbonyl)-7-phenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 56817974 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-(1-ethyl-2,5-dimethylpyrrole-3-carbonyl)-7-phenyl-1,4-diazepan-5-one |
| SMILES | CCn1c(C)cc(C(=O)N2CCNC(=O)CC2c2ccccc2)c1C |
| InChI | InChI=1S/C20H25N3O2/c1-4-22-14(2)12-17(15(22)3)20(25)23-11-10-21-19(24)13-18(23)16-8-6-5-7-9-16/h5-9,12,18H,4,10-11,13H2,1-3H3,(H,21,24) |
| InChIKey | BYUODTPDRKIMMH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |