C16H21N3O4 — CID 122023249
4-[(5-oxo-7-phenyl-1,4-diazepane-1-carbonyl)amino]butanoic acid (PubChem CID 122023249) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-[(5-oxo-7-phenyl-1,4-diazepane-1-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(5-oxo-7-phenyl-1,4-diazepane-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122023249 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-[(5-oxo-7-phenyl-1,4-diazepane-1-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCNC(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C16H21N3O4/c20-14-11-13(12-5-2-1-3-6-12)19(10-9-17-14)16(23)18-8-4-7-15(21)22/h1-3,5-6,13H,4,7-11H2,(H,17,20)(H,18,23)(H,21,22) |
| InChIKey | UNEOPAKKSAWSAM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|