C16H17N5O2 — CID 124622403
(7R)-5-oxo-7-phenyl-N-pyrimidin-4-yl-1,4-diazepane-1-carboxamide (PubChem CID 124622403) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is (7R)-5-oxo-7-phenyl-N-pyrimidin-4-yl-1,4-diazepane-1-carboxamide.
| Compound Name | (7R)-5-oxo-7-phenyl-N-pyrimidin-4-yl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 124622403 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (7R)-5-oxo-7-phenyl-N-pyrimidin-4-yl-1,4-diazepane-1-carboxamide |
| SMILES | O=C1C[C@H](c2ccccc2)N(C(=O)Nc2ccncn2)CCN1 |
| InChI | InChI=1S/C16H17N5O2/c22-15-10-13(12-4-2-1-3-5-12)21(9-8-18-15)16(23)20-14-6-7-17-11-19-14/h1-7,11,13H,8-10H2,(H,18,22)(H,17,19,20,23)/t13-/m1/s1 |
| InChIKey | IEHIWUHWODLLTN-CYBMUJFWSA-N |
| XLogP | 1.57 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |