C25H30N4O2 — CID 86840309
(Z)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-(5-oxo-7-phenyl-1,4-diazepane-1-carbonyl)prop-2-enenitrile (PubChem CID 86840309) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (Z)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-(5-oxo-7-phenyl-1,4-diazepane-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-(5-oxo-7-phenyl-1,4-diazepane-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 86840309 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (Z)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-(5-oxo-7-phenyl-1,4-diazepane-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)N2CCNC(=O)CC2c2ccccc2)c(C)n1CC(C)C |
| InChI | InChI=1S/C25H30N4O2/c1-17(2)16-29-18(3)12-21(19(29)4)13-22(15-26)25(31)28-11-10-27-24(30)14-23(28)20-8-6-5-7-9-20/h5-9,12-13,17,23H,10-11,14,16H2,1-4H3,(H,27,30)/b22-13- |
| InChIKey | DFCLPUJXCMJNTE-XKZIYDEJSA-N |
| XLogP | 3.76 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|