C22H31N3O3 — CID 134058147
(E)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-[2-(1,3-dioxolan-2-yl)piperidine-1-carbonyl]prop-2-enenitrile (PubChem CID 134058147) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is (E)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-[2-(1,3-dioxolan-2-yl)piperidine-1-carbonyl]prop-2-enenitrile.
| Compound Name | (E)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-[2-(1,3-dioxolan-2-yl)piperidine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 134058147 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (E)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-[2-(1,3-dioxolan-2-yl)piperidine-1-carbonyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)N2CCCCC2C2OCCO2)c(C)n1CC(C)C |
| InChI | InChI=1S/C22H31N3O3/c1-15(2)14-25-16(3)11-18(17(25)4)12-19(13-23)21(26)24-8-6-5-7-20(24)22-27-9-10-28-22/h11-12,15,20,22H,5-10,14H2,1-4H3/b19-12+ |
| InChIKey | ZYLCKGCREXJXOD-XDHOZWIPSA-N |
| XLogP | 3.42 |
| TPSA | 67.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|