C24H28N4O2 — CID 86874660
(Z)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-(3-oxo-2-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 86874660) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (Z)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-(3-oxo-2-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-(3-oxo-2-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 86874660 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (Z)-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]-2-(3-oxo-2-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)N2CCNC(=O)C2c2ccccc2)c(C)n1CC(C)C |
| InChI | InChI=1S/C24H28N4O2/c1-16(2)15-28-17(3)12-20(18(28)4)13-21(14-25)24(30)27-11-10-26-23(29)22(27)19-8-6-5-7-9-19/h5-9,12-13,16,22H,10-11,15H2,1-4H3,(H,26,29)/b21-13- |
| InChIKey | YAWZUECNDXWXHP-BKUYFWCQSA-N |
| XLogP | 3.37 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|