C21H29N3O3 — CID 4574262
(3-nitro-4-pyrrolidin-1-ylphenyl)-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone (PubChem CID 4574262) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (3-nitro-4-pyrrolidin-1-ylphenyl)-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone.
| Compound Name | (3-nitro-4-pyrrolidin-1-ylphenyl)-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone |
|---|---|
| PubChem CID | 4574262 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (3-nitro-4-pyrrolidin-1-ylphenyl)-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methanone |
| SMILES | CC1(C)CC2CC(C)(CN2C(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C21H29N3O3/c1-20(2)11-16-12-21(3,13-20)14-23(16)19(25)15-6-7-17(18(10-15)24(26)27)22-8-4-5-9-22/h6-7,10,16H,4-5,8-9,11-14H2,1-3H3 |
| InChIKey | YJVLPSAQUIWGPP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|