C12H13N3O5 — CID 115602215
4-(3-methoxy-4-nitrobenzoyl)piperazin-2-one (PubChem CID 115602215) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is 4-(3-methoxy-4-nitrobenzoyl)piperazin-2-one.
| Compound Name | 4-(3-methoxy-4-nitrobenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 115602215 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-(3-methoxy-4-nitrobenzoyl)piperazin-2-one |
| SMILES | COc1cc(C(=O)N2CCNC(=O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O5/c1-20-10-6-8(2-3-9(10)15(18)19)12(17)14-5-4-13-11(16)7-14/h2-3,6H,4-5,7H2,1H3,(H,13,16) |
| InChIKey | HGSFWZKTZHCVHF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|