C21H22ClN3O3 — CID 119414754
2-benzyl-5-(1,4-diazepane-1-carbonyl)isoindole-1,3-dione;hydrochloride (PubChem CID 119414754) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-benzyl-5-(1,4-diazepane-1-carbonyl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-benzyl-5-(1,4-diazepane-1-carbonyl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119414754 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-benzyl-5-(1,4-diazepane-1-carbonyl)isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C(c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O)N1CCCNCC1 |
| InChI | InChI=1S/C21H21N3O3.ClH/c25-19(23-11-4-9-22-10-12-23)16-7-8-17-18(13-16)21(27)24(20(17)26)14-15-5-2-1-3-6-15;/h1-3,5-8,13,22H,4,9-12,14H2;1H |
| InChIKey | JNSLCJDJPLNUSH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|