C25H21ClN4O3 — CID 55877621
2-benzyl-5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]isoindole-1,3-dione (PubChem CID 55877621) has the molecular formula C25H21ClN4O3 and a molecular weight of 460.92 g/mol. Its IUPAC name is 2-benzyl-5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-benzyl-5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55877621 |
| Molecular Formula | C25H21ClN4O3 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-benzyl-5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O)N1CCN(c2cccc(Cl)n2)CC1 |
| InChI | InChI=1S/C25H21ClN4O3/c26-21-7-4-8-22(27-21)28-11-13-29(14-12-28)23(31)18-9-10-19-20(15-18)25(33)30(24(19)32)16-17-5-2-1-3-6-17/h1-10,15H,11-14,16H2 |
| InChIKey | IDNCZKXHLSROJR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|