C21H27ClN4O4S — CID 55860230
5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]-N,N-diethyl-2-methoxybenzenesulfonamide (PubChem CID 55860230) has the molecular formula C21H27ClN4O4S and a molecular weight of 466.99 g/mol. Its IUPAC name is 5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]-N,N-diethyl-2-methoxybenzenesulfonamide.
| Compound Name | 5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]-N,N-diethyl-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 55860230 |
| Molecular Formula | C21H27ClN4O4S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]-N,N-diethyl-2-methoxybenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N2CCN(c3cccc(Cl)n3)CC2)ccc1OC |
| InChI | InChI=1S/C21H27ClN4O4S/c1-4-26(5-2)31(28,29)18-15-16(9-10-17(18)30-3)21(27)25-13-11-24(12-14-25)20-8-6-7-19(22)23-20/h6-10,15H,4-5,11-14H2,1-3H3 |
| InChIKey | WKXOXGOUGJXCQG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|