C18H28N4O5S — CID 55566418
2-[4-[3-(dimethylsulfamoyl)-4-methoxybenzoyl]piperazin-1-yl]-N-ethylacetamide (PubChem CID 55566418) has the molecular formula C18H28N4O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[4-[3-(dimethylsulfamoyl)-4-methoxybenzoyl]piperazin-1-yl]-N-ethylacetamide.
| Compound Name | 2-[4-[3-(dimethylsulfamoyl)-4-methoxybenzoyl]piperazin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 55566418 |
| Molecular Formula | C18H28N4O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 2-[4-[3-(dimethylsulfamoyl)-4-methoxybenzoyl]piperazin-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CCN(C(=O)c2ccc(OC)c(S(=O)(=O)N(C)C)c2)CC1 |
| InChI | InChI=1S/C18H28N4O5S/c1-5-19-17(23)13-21-8-10-22(11-9-21)18(24)14-6-7-15(27-4)16(12-14)28(25,26)20(2)3/h6-7,12H,5,8-11,13H2,1-4H3,(H,19,23) |
| InChIKey | CGFRQILBPMNDQI-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |