C15H24Cl2N4O2 — CID 119843977
2-[4-(4-aminobenzoyl)piperazin-1-yl]-N-ethylacetamide;dihydrochloride (PubChem CID 119843977) has the molecular formula C15H24Cl2N4O2 and a molecular weight of 363.29 g/mol. Its IUPAC name is 2-[4-(4-aminobenzoyl)piperazin-1-yl]-N-ethylacetamide;dihydrochloride.
| Compound Name | 2-[4-(4-aminobenzoyl)piperazin-1-yl]-N-ethylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119843977 |
| Molecular Formula | C15H24Cl2N4O2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[4-(4-aminobenzoyl)piperazin-1-yl]-N-ethylacetamide;dihydrochloride |
| SMILES | CCNC(=O)CN1CCN(C(=O)c2ccc(N)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H22N4O2.2ClH/c1-2-17-14(20)11-18-7-9-19(10-8-18)15(21)12-3-5-13(16)6-4-12;;/h3-6H,2,7-11,16H2,1H3,(H,17,20);2*1H |
| InChIKey | JUSAGZWOOVRJQL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|