C15H22N4O2 — CID 60937139
2-[4-(4-aminobenzoyl)piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 60937139) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[4-(4-aminobenzoyl)piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(4-aminobenzoyl)piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60937139 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-[4-(4-aminobenzoyl)piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(C(=O)c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C15H22N4O2/c1-17(2)14(20)11-18-7-9-19(10-8-18)15(21)12-3-5-13(16)6-4-12/h3-6H,7-11,16H2,1-2H3 |
| InChIKey | BYCVCVANXKFZPP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|