C17H25N3O5S — CID 110295888
ethyl 4-[3-(dimethylsulfamoyl)-4-methylbenzoyl]piperazine-1-carboxylate (PubChem CID 110295888) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is ethyl 4-[3-(dimethylsulfamoyl)-4-methylbenzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(dimethylsulfamoyl)-4-methylbenzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110295888 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | ethyl 4-[3-(dimethylsulfamoyl)-4-methylbenzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(C)c(S(=O)(=O)N(C)C)c2)CC1 |
| InChI | InChI=1S/C17H25N3O5S/c1-5-25-17(22)20-10-8-19(9-11-20)16(21)14-7-6-13(2)15(12-14)26(23,24)18(3)4/h6-7,12H,5,8-11H2,1-4H3 |
| InChIKey | GGVXEOQJDGVXKL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |