C16H20N2O5 — CID 110808937
ethyl 4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepane-1-carboxylate (PubChem CID 110808937) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl 4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepane-1-carboxylate.
| Compound Name | ethyl 4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110808937 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 4-(1,3-benzodioxole-5-carbonyl)-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H20N2O5/c1-2-21-16(20)18-7-3-6-17(8-9-18)15(19)12-4-5-13-14(10-12)23-11-22-13/h4-5,10H,2-3,6-9,11H2,1H3 |
| InChIKey | YFEDRLIKBAYFFV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |