C21H22N2O4 — CID 36628594
1,3-benzodioxol-5-yl-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 36628594) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 36628594 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-(3-methylbenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1cccc(C(=O)N2CCCN(C(=O)c3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-15-4-2-5-16(12-15)20(24)22-8-3-9-23(11-10-22)21(25)17-6-7-18-19(13-17)27-14-26-18/h2,4-7,12-13H,3,8-11,14H2,1H3 |
| InChIKey | HOWVIPDGJQJBDE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |