C16H20N2O4 — CID 36869549
1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]butan-1-one (PubChem CID 36869549) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 36869549 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H20N2O4/c1-2-3-15(19)17-6-8-18(9-7-17)16(20)12-4-5-13-14(10-12)22-11-21-13/h4-5,10H,2-3,6-9,11H2,1H3 |
| InChIKey | BUGBESFHEXKNLZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |