C23H26Cl2N4O3 — CID 55876984
[1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 55876984) has the molecular formula C23H26Cl2N4O3 and a molecular weight of 477.39 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55876984 |
| Molecular Formula | C23H26Cl2N4O3 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC(C(=O)N2CCN(c3cccc(Cl)n3)CC2)CC1 |
| InChI | InChI=1S/C23H26Cl2N4O3/c1-32-19-6-5-17(24)15-18(19)23(31)28-9-7-16(8-10-28)22(30)29-13-11-27(12-14-29)21-4-2-3-20(25)26-21/h2-6,15-16H,7-14H2,1H3 |
| InChIKey | JTWPZWBFCZPVAD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|