C20H23Cl2N5O — CID 55876732
[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methanone (PubChem CID 55876732) has the molecular formula C20H23Cl2N5O and a molecular weight of 420.34 g/mol. Its IUPAC name is [4-(6-chloro-2-pyridinyl)piperazin-1-yl]-[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methanone.
| Compound Name | [4-(6-chloro-2-pyridinyl)piperazin-1-yl]-[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55876732 |
| Molecular Formula | C20H23Cl2N5O |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [4-(6-chloro-2-pyridinyl)piperazin-1-yl]-[1-(5-chloro-2-pyridinyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ccc(Cl)cn2)CC1)N1CCN(c2cccc(Cl)n2)CC1 |
| InChI | InChI=1S/C20H23Cl2N5O/c21-16-4-5-18(23-14-16)25-8-6-15(7-9-25)20(28)27-12-10-26(11-13-27)19-3-1-2-17(22)24-19/h1-5,14-15H,6-13H2 |
| InChIKey | UYQAWZARTNKAFJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|