C16H23ClN4O — CID 95622258
[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-[(2S)-1-methylpiperidin-2-yl]methanone (PubChem CID 95622258) has the molecular formula C16H23ClN4O and a molecular weight of 322.84 g/mol. Its IUPAC name is [4-(6-chloro-2-pyridinyl)piperazin-1-yl]-[(2S)-1-methylpiperidin-2-yl]methanone.
| Compound Name | [4-(6-chloro-2-pyridinyl)piperazin-1-yl]-[(2S)-1-methylpiperidin-2-yl]methanone |
|---|---|
| PubChem CID | 95622258 |
| Molecular Formula | C16H23ClN4O |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [4-(6-chloro-2-pyridinyl)piperazin-1-yl]-[(2S)-1-methylpiperidin-2-yl]methanone |
| SMILES | CN1CCCC[C@H]1C(=O)N1CCN(c2cccc(Cl)n2)CC1 |
| InChI | InChI=1S/C16H23ClN4O/c1-19-8-3-2-5-13(19)16(22)21-11-9-20(10-12-21)15-7-4-6-14(17)18-15/h4,6-7,13H,2-3,5,8-12H2,1H3/t13-/m0/s1 |
| InChIKey | FEEQVVPIBOFYIU-ZDUSSCGKSA-N |
| XLogP | 1.87 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|