C17H16Cl3N3O — CID 60526232
1-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-2-(2,6-dichlorophenyl)ethanone (PubChem CID 60526232) has the molecular formula C17H16Cl3N3O and a molecular weight of 384.69 g/mol. Its IUPAC name is 1-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-2-(2,6-dichlorophenyl)ethanone.
| Compound Name | 1-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-2-(2,6-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 60526232 |
| Molecular Formula | C17H16Cl3N3O |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 1-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-2-(2,6-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)N1CCN(c2cccc(Cl)n2)CC1 |
| InChI | InChI=1S/C17H16Cl3N3O/c18-13-3-1-4-14(19)12(13)11-17(24)23-9-7-22(8-10-23)16-6-2-5-15(20)21-16/h1-6H,7-11H2 |
| InChIKey | QIVGWCAHLLQXJX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|