C17H17ClFN3O — CID 8004063
2-(2-chloro-6-fluorophenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone (PubChem CID 8004063) has the molecular formula C17H17ClFN3O and a molecular weight of 333.79 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 8004063 |
| Molecular Formula | C17H17ClFN3O |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C17H17ClFN3O/c18-14-4-3-5-15(19)13(14)12-17(23)22-10-8-21(9-11-22)16-6-1-2-7-20-16/h1-7H,8-12H2 |
| InChIKey | TZVVWQJWTWCMJY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |