C18H21ClFN5O — CID 122350887
2-(2-chloro-6-fluorophenyl)-1-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]ethanone (PubChem CID 122350887) has the molecular formula C18H21ClFN5O and a molecular weight of 377.85 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122350887 |
| Molecular Formula | C18H21ClFN5O |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[4-[6-(ethylamino)pyridazin-3-yl]piperazin-1-yl]ethanone |
| SMILES | CCNc1ccc(N2CCN(C(=O)Cc3c(F)cccc3Cl)CC2)nn1 |
| InChI | InChI=1S/C18H21ClFN5O/c1-2-21-16-6-7-17(23-22-16)24-8-10-25(11-9-24)18(26)12-13-14(19)4-3-5-15(13)20/h3-7H,2,8-12H2,1H3,(H,21,22) |
| InChIKey | MGLHRHFLTXZIGN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |