C17H23ClN4O — CID 138806991
1-azabicyclo[2.2.2]octan-2-yl-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 138806991) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-2-yl-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | 1-azabicyclo[2.2.2]octan-2-yl-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 138806991 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-2-yl-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CC2CCN1CC2)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H23ClN4O/c18-14-1-2-16(19-12-14)21-7-9-22(10-8-21)17(23)15-11-13-3-5-20(15)6-4-13/h1-2,12-13,15H,3-11H2 |
| InChIKey | CLSBFOXEIXEAJI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |