C17H26ClN5O — CID 72577389
[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-(4-propan-2-ylpiperazin-2-yl)methanone (PubChem CID 72577389) has the molecular formula C17H26ClN5O and a molecular weight of 351.88 g/mol. Its IUPAC name is [4-(5-chloro-2-pyridinyl)piperazin-1-yl]-(4-propan-2-ylpiperazin-2-yl)methanone.
| Compound Name | [4-(5-chloro-2-pyridinyl)piperazin-1-yl]-(4-propan-2-ylpiperazin-2-yl)methanone |
|---|---|
| PubChem CID | 72577389 |
| Molecular Formula | C17H26ClN5O |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [4-(5-chloro-2-pyridinyl)piperazin-1-yl]-(4-propan-2-ylpiperazin-2-yl)methanone |
| SMILES | CC(C)N1CCNC(C(=O)N2CCN(c3ccc(Cl)cn3)CC2)C1 |
| InChI | InChI=1S/C17H26ClN5O/c1-13(2)23-6-5-19-15(12-23)17(24)22-9-7-21(8-10-22)16-4-3-14(18)11-20-16/h3-4,11,13,15,19H,5-10,12H2,1-2H3 |
| InChIKey | UVXBYLMMHZIEFW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |