C19H29ClN4O2 — CID 141317152
[4-(3-chloro-4-methoxyphenyl)piperazin-1-yl]-[(2R)-4-propan-2-ylpiperazin-2-yl]methanone (PubChem CID 141317152) has the molecular formula C19H29ClN4O2 and a molecular weight of 380.92 g/mol. Its IUPAC name is [4-(3-chloro-4-methoxyphenyl)piperazin-1-yl]-[(2R)-4-propan-2-ylpiperazin-2-yl]methanone.
| Compound Name | [4-(3-chloro-4-methoxyphenyl)piperazin-1-yl]-[(2R)-4-propan-2-ylpiperazin-2-yl]methanone |
|---|---|
| PubChem CID | 141317152 |
| Molecular Formula | C19H29ClN4O2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [4-(3-chloro-4-methoxyphenyl)piperazin-1-yl]-[(2R)-4-propan-2-ylpiperazin-2-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@H]3CN(C(C)C)CCN3)CC2)cc1Cl |
| InChI | InChI=1S/C19H29ClN4O2/c1-14(2)24-7-6-21-17(13-24)19(25)23-10-8-22(9-11-23)15-4-5-18(26-3)16(20)12-15/h4-5,12,14,17,21H,6-11,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | FVKPDWXRYOSTGL-QGZVFWFLSA-N |
| XLogP | 1.68 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|