C25H30ClN3O3 — CID 55764495
[1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-(2-pyridin-4-ylazepan-1-yl)methanone (PubChem CID 55764495) has the molecular formula C25H30ClN3O3 and a molecular weight of 455.99 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-(2-pyridin-4-ylazepan-1-yl)methanone.
| Compound Name | [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-(2-pyridin-4-ylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 55764495 |
| Molecular Formula | C25H30ClN3O3 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-(2-pyridin-4-ylazepan-1-yl)methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC(C(=O)N2CCCCCC2c2ccncc2)CC1 |
| InChI | InChI=1S/C25H30ClN3O3/c1-32-23-7-6-20(26)17-21(23)25(31)28-15-10-19(11-16-28)24(30)29-14-4-2-3-5-22(29)18-8-12-27-13-9-18/h6-9,12-13,17,19,22H,2-5,10-11,14-16H2,1H3 |
| InChIKey | HISMBUNLPBRVSO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |