C23H32ClN3O3 — CID 56551226
[1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 56551226) has the molecular formula C23H32ClN3O3 and a molecular weight of 433.98 g/mol. Its IUPAC name is [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 56551226 |
| Molecular Formula | C23H32ClN3O3 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [1-(5-chloro-2-methoxybenzoyl)piperidin-4-yl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC(C(=O)N2CCC(N3CCCC3)CC2)CC1 |
| InChI | InChI=1S/C23H32ClN3O3/c1-30-21-5-4-18(24)16-20(21)23(29)27-12-6-17(7-13-27)22(28)26-14-8-19(9-15-26)25-10-2-3-11-25/h4-5,16-17,19H,2-3,6-15H2,1H3 |
| InChIKey | FLQJETSNSSGWFN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |