C19H22ClNO5S — CID 42070012
(2-chlorophenyl)methyl 3-(diethylsulfamoyl)-4-methoxybenzoate (PubChem CID 42070012) has the molecular formula C19H22ClNO5S and a molecular weight of 411.91 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 3-(diethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | (2-chlorophenyl)methyl 3-(diethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 42070012 |
| Molecular Formula | C19H22ClNO5S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (2-chlorophenyl)methyl 3-(diethylsulfamoyl)-4-methoxybenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCc2ccccc2Cl)ccc1OC |
| InChI | InChI=1S/C19H22ClNO5S/c1-4-21(5-2)27(23,24)18-12-14(10-11-17(18)25-3)19(22)26-13-15-8-6-7-9-16(15)20/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | RDPBXQQAXURJTR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |