C25H34N2O6S — CID 16512591
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate (PubChem CID 16512591) has the molecular formula C25H34N2O6S and a molecular weight of 490.62 g/mol. Its IUPAC name is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 16512591 |
| Molecular Formula | C25H34N2O6S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(diethylsulfamoyl)-4-methoxybenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)N(Cc2ccccc2)C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C25H34N2O6S/c1-7-26(8-2)34(30,31)22-16-20(14-15-21(22)32-6)24(29)33-18-23(28)27(25(3,4)5)17-19-12-10-9-11-13-19/h9-16H,7-8,17-18H2,1-6H3 |
| InChIKey | OZYBGAYOPAVILT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |