C26H33ClN2O5S — CID 3951592
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate (PubChem CID 3951592) has the molecular formula C26H33ClN2O5S and a molecular weight of 521.08 g/mol. Its IUPAC name is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate.
| Compound Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 3951592 |
| Molecular Formula | C26H33ClN2O5S |
| Molecular Weight | 521.08 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C26H33ClN2O5S/c1-26(2,3)29(18-20-11-7-6-8-12-20)24(30)19-34-25(31)21-13-14-22(27)23(17-21)35(32,33)28-15-9-4-5-10-16-28/h6-8,11-14,17H,4-5,9-10,15-16,18-19H2,1-3H3 |
| InChIKey | ZROGJGWKFBTBIF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.08 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |