C20H25NO6S — CID 24530085
2-ethoxyethyl 3-[benzyl(methyl)sulfamoyl]-4-methoxybenzoate (PubChem CID 24530085) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-ethoxyethyl 3-[benzyl(methyl)sulfamoyl]-4-methoxybenzoate.
| Compound Name | 2-ethoxyethyl 3-[benzyl(methyl)sulfamoyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 24530085 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-ethoxyethyl 3-[benzyl(methyl)sulfamoyl]-4-methoxybenzoate |
| SMILES | CCOCCOC(=O)c1ccc(OC)c(S(=O)(=O)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H25NO6S/c1-4-26-12-13-27-20(22)17-10-11-18(25-3)19(14-17)28(23,24)21(2)15-16-8-6-5-7-9-16/h5-11,14H,4,12-13,15H2,1-3H3 |
| InChIKey | GJXIFPGAHOSDBL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|