C19H23ClN2O3S — CID 119416326
(3-benzylsulfonylphenyl)-(1,4-diazepan-1-yl)methanone;hydrochloride (PubChem CID 119416326) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is (3-benzylsulfonylphenyl)-(1,4-diazepan-1-yl)methanone;hydrochloride.
| Compound Name | (3-benzylsulfonylphenyl)-(1,4-diazepan-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119416326 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (3-benzylsulfonylphenyl)-(1,4-diazepan-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cccc(S(=O)(=O)Cc2ccccc2)c1)N1CCCNCC1 |
| InChI | InChI=1S/C19H22N2O3S.ClH/c22-19(21-12-5-10-20-11-13-21)17-8-4-9-18(14-17)25(23,24)15-16-6-2-1-3-7-16;/h1-4,6-9,14,20H,5,10-13,15H2;1H |
| InChIKey | LQFRYFFGEMHISA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |