C20H26ClN3O3S — CID 119446967
3-benzylsulfonyl-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride (PubChem CID 119446967) has the molecular formula C20H26ClN3O3S and a molecular weight of 423.97 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride.
| Compound Name | 3-benzylsulfonyl-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119446967 |
| Molecular Formula | C20H26ClN3O3S |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-benzylsulfonyl-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCNCC1)c1cccc(S(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H25N3O3S.ClH/c24-20(22-11-14-23-12-9-21-10-13-23)18-7-4-8-19(15-18)27(25,26)16-17-5-2-1-3-6-17;/h1-8,15,21H,9-14,16H2,(H,22,24);1H |
| InChIKey | VXCASAMLZSUFNV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |