C21H27ClN4O2 — CID 119447939
3-benzamido-4-methyl-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride (PubChem CID 119447939) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 3-benzamido-4-methyl-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride.
| Compound Name | 3-benzamido-4-methyl-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119447939 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-benzamido-4-methyl-N-(2-piperazin-1-ylethyl)benzamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)NCCN2CCNCC2)cc1NC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C21H26N4O2.ClH/c1-16-7-8-18(20(26)23-11-14-25-12-9-22-10-13-25)15-19(16)24-21(27)17-5-3-2-4-6-17;/h2-8,15,22H,9-14H2,1H3,(H,23,26)(H,24,27);1H |
| InChIKey | QDABMKXXTIIGNB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |