C21H27N5O2 — CID 119448778
4-methyl-3-(phenylcarbamoylamino)-N-(2-piperazin-1-ylethyl)benzamide (PubChem CID 119448778) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-methyl-3-(phenylcarbamoylamino)-N-(2-piperazin-1-ylethyl)benzamide.
| Compound Name | 4-methyl-3-(phenylcarbamoylamino)-N-(2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 119448778 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-methyl-3-(phenylcarbamoylamino)-N-(2-piperazin-1-ylethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCCN2CCNCC2)cc1NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H27N5O2/c1-16-7-8-17(20(27)23-11-14-26-12-9-22-10-13-26)15-19(16)25-21(28)24-18-5-3-2-4-6-18/h2-8,15,22H,9-14H2,1H3,(H,23,27)(H2,24,25,28) |
| InChIKey | BNXCRCNKROIGJD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |