C16H26N4O3S — CID 119392350
3-(methanesulfonamido)-4-methyl-N-(3-piperazin-1-ylpropyl)benzamide (PubChem CID 119392350) has the molecular formula C16H26N4O3S and a molecular weight of 354.48 g/mol. Its IUPAC name is 3-(methanesulfonamido)-4-methyl-N-(3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 3-(methanesulfonamido)-4-methyl-N-(3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 119392350 |
| Molecular Formula | C16H26N4O3S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-(methanesulfonamido)-4-methyl-N-(3-piperazin-1-ylpropyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCCCN2CCNCC2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C16H26N4O3S/c1-13-4-5-14(12-15(13)19-24(2,22)23)16(21)18-6-3-9-20-10-7-17-8-11-20/h4-5,12,17,19H,3,6-11H2,1-2H3,(H,18,21) |
| InChIKey | BCERRTXCSICOJA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|