C20H24N4O2 — CID 119418250
1-[5-(1,4-diazepane-1-carbonyl)-2-methylphenyl]-3-phenylurea (PubChem CID 119418250) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[5-(1,4-diazepane-1-carbonyl)-2-methylphenyl]-3-phenylurea.
| Compound Name | 1-[5-(1,4-diazepane-1-carbonyl)-2-methylphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 119418250 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[5-(1,4-diazepane-1-carbonyl)-2-methylphenyl]-3-phenylurea |
| SMILES | Cc1ccc(C(=O)N2CCCNCC2)cc1NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H24N4O2/c1-15-8-9-16(19(25)24-12-5-10-21-11-13-24)14-18(15)23-20(26)22-17-6-3-2-4-7-17/h2-4,6-9,14,21H,5,10-13H2,1H3,(H2,22,23,26) |
| InChIKey | AJSRDALLGPBHKJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |