About 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide
3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide (PubChem CID 23885173) has the molecular formula C20H22ClN3O2
and a molecular weight of 371.87 g/mol. Its IUPAC name is 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide.
Molecular Properties
| Compound Name | 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide |
| PubChem CID | 23885173 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide |
| SMILES | Cc1cc(C(=O)N2CCCNCC2)ccc1NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-14-12-16(20(26)24-10-3-8-22-9-11-24)6-7-18(14)23-19(25)15-4-2-5-17(21)13-15/h2,4-7,12-13,22H,3,8-11H2,1H3,(H,23,25) |
| InChIKey | JYVJMJHEAWDDFD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide?
The IUPAC name of 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide (CID 23885173) is 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide.
What is the SMILES notation for 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide?
The canonical SMILES for 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide is Cc1cc(C(=O)N2CCCNCC2)ccc1NC(=O)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide?
The InChIKey is JYVJMJHEAWDDFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClN3O2/c1-14-12-16(20(26)24-10-3-8-22-9-11-24)6-7-18(14)23-19(25)15-4-2-5-17(21)13-15/h2,4-7,12-13,22H,3,8-11H2,1H3,(H,23,25).
What are the key properties of 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide?
3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide has a molecular weight of 371.87 g/mol, XLogP of 3.34, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide is sourced from PubChem (CID 23885173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).