C20H22ClN3O2 — CID 23885173
3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide (PubChem CID 23885173) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide.
| Compound Name | 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 23885173 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-chloro-N-[4-(1,4-diazepane-1-carbonyl)-2-methylphenyl]benzamide |
| SMILES | Cc1cc(C(=O)N2CCCNCC2)ccc1NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-14-12-16(20(26)24-10-3-8-22-9-11-24)6-7-18(14)23-19(25)15-4-2-5-17(21)13-15/h2,4-7,12-13,22H,3,8-11H2,1H3,(H,23,25) |
| InChIKey | JYVJMJHEAWDDFD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |