C20H22ClN3O2 — CID 23908069
3-chloro-N-[2-[2-(1,4-diazepan-1-yl)-2-oxoethyl]phenyl]benzamide (PubChem CID 23908069) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-(1,4-diazepan-1-yl)-2-oxoethyl]phenyl]benzamide.
| Compound Name | 3-chloro-N-[2-[2-(1,4-diazepan-1-yl)-2-oxoethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23908069 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-chloro-N-[2-[2-(1,4-diazepan-1-yl)-2-oxoethyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1CC(=O)N1CCCNCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O2/c21-17-7-3-6-16(13-17)20(26)23-18-8-2-1-5-15(18)14-19(25)24-11-4-9-22-10-12-24/h1-3,5-8,13,22H,4,9-12,14H2,(H,23,26) |
| InChIKey | GHCWWQDGVDQUFS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |