3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid

C15H21N3O3 — CID 107274027

IUPAC3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid
SMILESO=C(O)CCc1ccccc1NC(=O)N1CCCNCC1
InChIInChI=1S/C15H21N3O3/c19-14(20)7-6-12-4-1-2-5-13(12)17-15(21)18-10-3-8-16-9-11-18/h1-2,4-5,16H,3,6-11H2,(H,17,21)(H,19,20)
InChIKeyABDRMRLLJOQBJE-UHFFFAOYSA-N
MW291.35 g/mol
LogP1.53
Rot. Bonds4

About 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid

3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid (PubChem CID 107274027) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid.

Molecular Properties

Compound Name3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid
PubChem CID107274027
Molecular FormulaC15H21N3O3
Molecular Weight291.35 g/mol
Exact Mass291.16
IUPAC Name3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid
SMILESO=C(O)CCc1ccccc1NC(=O)N1CCCNCC1
InChIInChI=1S/C15H21N3O3/c19-14(20)7-6-12-4-1-2-5-13(12)17-15(21)18-10-3-8-16-9-11-18/h1-2,4-5,16H,3,6-11H2,(H,17,21)(H,19,20)
InChIKeyABDRMRLLJOQBJE-UHFFFAOYSA-N
XLogP1.53
TPSA81.67 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 51.53
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid?
The IUPAC name of 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid (CID 107274027) is 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid.
What is the SMILES notation for 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid?
The canonical SMILES for 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid is O=C(O)CCc1ccccc1NC(=O)N1CCCNCC1.
What is the InChIKey of 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid?
The InChIKey is ABDRMRLLJOQBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3/c19-14(20)7-6-12-4-1-2-5-13(12)17-15(21)18-10-3-8-16-9-11-18/h1-2,4-5,16H,3,6-11H2,(H,17,21)(H,19,20).
What are the key properties of 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid?
3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid has a molecular weight of 291.35 g/mol, XLogP of 1.53, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,4-diazepane-1-carbonylamino)phenyl]propanoic acid is sourced from PubChem (CID 107274027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).